C19H34O3Si — CID 10969821
methyl 2-[(1S,4S,5S)-4-[tert-butyl(dimethyl)silyl]oxy-5-[(Z)-pent-2-enyl]cyclopent-2-en-1-yl]acetate (PubChem CID 10969821) has the molecular formula C19H34O3Si and a molecular weight of 338.56 g/mol. Its IUPAC name is methyl 2-[(1S,4S,5S)-4-[tert-butyl(dimethyl)silyl]oxy-5-[(Z)-pent-2-enyl]cyclopent-2-en-1-yl]acetate.
| Compound Name | methyl 2-[(1S,4S,5S)-4-[tert-butyl(dimethyl)silyl]oxy-5-[(Z)-pent-2-enyl]cyclopent-2-en-1-yl]acetate |
|---|---|
| PubChem CID | 10969821 |
| Molecular Formula | C19H34O3Si |
| Molecular Weight | 338.56 g/mol |
| Exact Mass | 338.23 |
| IUPAC Name | methyl 2-[(1S,4S,5S)-4-[tert-butyl(dimethyl)silyl]oxy-5-[(Z)-pent-2-enyl]cyclopent-2-en-1-yl]acetate |
| SMILES | CC/C=C\C[C@H]1[C@@H](CC(=O)OC)C=C[C@@H]1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C19H34O3Si/c1-8-9-10-11-16-15(14-18(20)21-5)12-13-17(16)22-23(6,7)19(2,3)4/h9-10,12-13,15-17H,8,11,14H2,1-7H3/b10-9-/t15-,16+,17+/m1/s1 |
| InChIKey | ZEBQCMAHTVGZNZ-USAJIHADSA-N |
| XLogP | 5.10 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.56 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|