C24H34O2 — CID 10970285
[(1R,2S,5R)-5-methyl-2-(2-phenylpropan-2-yl)cyclohexyl] 2-[(1S)-2-methylidenecyclopentyl]acetate (PubChem CID 10970285) has the molecular formula C24H34O2 and a molecular weight of 354.53 g/mol. Its IUPAC name is [(1R,2S,5R)-5-methyl-2-(2-phenylpropan-2-yl)cyclohexyl] 2-[(1S)-2-methylidenecyclopentyl]acetate.
| Compound Name | [(1R,2S,5R)-5-methyl-2-(2-phenylpropan-2-yl)cyclohexyl] 2-[(1S)-2-methylidenecyclopentyl]acetate |
|---|---|
| PubChem CID | 10970285 |
| Molecular Formula | C24H34O2 |
| Molecular Weight | 354.53 g/mol |
| Exact Mass | 354.26 |
| IUPAC Name | [(1R,2S,5R)-5-methyl-2-(2-phenylpropan-2-yl)cyclohexyl] 2-[(1S)-2-methylidenecyclopentyl]acetate |
| SMILES | C=C1CCC[C@H]1CC(=O)O[C@@H]1C[C@H](C)CC[C@H]1C(C)(C)c1ccccc1 |
| InChI | InChI=1S/C24H34O2/c1-17-13-14-21(24(3,4)20-11-6-5-7-12-20)22(15-17)26-23(25)16-19-10-8-9-18(19)2/h5-7,11-12,17,19,21-22H,2,8-10,13-16H2,1,3-4H3/t17-,19+,21-,22-/m1/s1 |
| InChIKey | KDNNTQKKQJKZHD-HGIWEUDGSA-N |
| XLogP | 6.06 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.53 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|