C19H25N3O2S — CID 10970415
4-(3-cyclohexyl-4,5,6,7-tetrahydroindazol-2-yl)benzenesulfonamide (PubChem CID 10970415) has the molecular formula C19H25N3O2S and a molecular weight of 359.50 g/mol. Its IUPAC name is 4-(3-cyclohexyl-4,5,6,7-tetrahydroindazol-2-yl)benzenesulfonamide.
| Compound Name | 4-(3-cyclohexyl-4,5,6,7-tetrahydroindazol-2-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 10970415 |
| Molecular Formula | C19H25N3O2S |
| Molecular Weight | 359.50 g/mol |
| Exact Mass | 359.17 |
| IUPAC Name | 4-(3-cyclohexyl-4,5,6,7-tetrahydroindazol-2-yl)benzenesulfonamide |
| SMILES | NS(=O)(=O)c1ccc(-n2nc3c(c2C2CCCCC2)CCCC3)cc1 |
| InChI | InChI=1S/C19H25N3O2S/c20-25(23,24)16-12-10-15(11-13-16)22-19(14-6-2-1-3-7-14)17-8-4-5-9-18(17)21-22/h10-14H,1-9H2,(H2,20,23,24) |
| InChIKey | GJHDSFUUCKVNOL-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 77.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.50 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |