C18H22FNO5S2 — CID 10971745
O-ethyl [1-[(4-fluorobenzoyl)-methoxycarbonylamino]-5-oxohexan-2-yl]sulfanylmethanethioate (PubChem CID 10971745) has the molecular formula C18H22FNO5S2 and a molecular weight of 415.51 g/mol. Its IUPAC name is O-ethyl [1-[(4-fluorobenzoyl)-methoxycarbonylamino]-5-oxohexan-2-yl]sulfanylmethanethioate.
| Compound Name | O-ethyl [1-[(4-fluorobenzoyl)-methoxycarbonylamino]-5-oxohexan-2-yl]sulfanylmethanethioate |
|---|---|
| PubChem CID | 10971745 |
| Molecular Formula | C18H22FNO5S2 |
| Molecular Weight | 415.51 g/mol |
| Exact Mass | 415.09 |
| IUPAC Name | O-ethyl [1-[(4-fluorobenzoyl)-methoxycarbonylamino]-5-oxohexan-2-yl]sulfanylmethanethioate |
| SMILES | CCOC(=S)SC(CCC(C)=O)CN(C(=O)OC)C(=O)c1ccc(F)cc1 |
| InChI | InChI=1S/C18H22FNO5S2/c1-4-25-18(26)27-15(10-5-12(2)21)11-20(17(23)24-3)16(22)13-6-8-14(19)9-7-13/h6-9,15H,4-5,10-11H2,1-3H3 |
| InChIKey | XMSGQIGBTHSEON-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.51 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|