C11H18ClHgNO3 — CID 10972363
[(3R,3aS,6aR)-4-[(2-methylpropan-2-yl)oxycarbonyl]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]pyrrol-3-yl]-chloromercury (PubChem CID 10972363) has the molecular formula C11H18ClHgNO3 and a molecular weight of 448.31 g/mol. Its IUPAC name is [(3R,3aS,6aR)-4-[(2-methylpropan-2-yl)oxycarbonyl]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]pyrrol-3-yl]-chloromercury.
| Compound Name | [(3R,3aS,6aR)-4-[(2-methylpropan-2-yl)oxycarbonyl]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]pyrrol-3-yl]-chloromercury |
|---|---|
| PubChem CID | 10972363 |
| Molecular Formula | C11H18ClHgNO3 |
| Molecular Weight | 448.31 g/mol |
| Exact Mass | 449.07 |
| IUPAC Name | [(3R,3aS,6aR)-4-[(2-methylpropan-2-yl)oxycarbonyl]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]pyrrol-3-yl]-chloromercury |
| SMILES | CC(C)(C)OC(=O)N1CC[C@H]2OC[C@H]([Hg]Cl)[C@H]21 |
| InChI | InChI=1S/C11H18NO3.ClH.Hg/c1-11(2,3)15-10(13)12-6-4-9-8(12)5-7-14-9;;/h5,8-9H,4,6-7H2,1-3H3;1H;/q;;+1/p-1/t8-,9-;;/m1../s1 |
| InChIKey | IXKAIQYYDSUCLI-UONRGADFSA-M |
| XLogP | 2.42 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.31 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|