C16H11IN2O2S — CID 1097329
(2S)-3-(4-iodophenyl)spiro[1,3-thiazolidine-2,3'-1H-indole]-2',4-dione (PubChem CID 1097329) has the molecular formula C16H11IN2O2S and a molecular weight of 422.25 g/mol. Its IUPAC name is (2S)-3-(4-iodophenyl)spiro[1,3-thiazolidine-2,3'-1H-indole]-2',4-dione.
| Compound Name | (2S)-3-(4-iodophenyl)spiro[1,3-thiazolidine-2,3'-1H-indole]-2',4-dione |
|---|---|
| PubChem CID | 1097329 |
| Molecular Formula | C16H11IN2O2S |
| Molecular Weight | 422.25 g/mol |
| Exact Mass | 421.96 |
| IUPAC Name | (2S)-3-(4-iodophenyl)spiro[1,3-thiazolidine-2,3'-1H-indole]-2',4-dione |
| SMILES | O=C1CS[C@@]2(C(=O)Nc3ccccc32)N1c1ccc(I)cc1 |
| InChI | InChI=1S/C16H11IN2O2S/c17-10-5-7-11(8-6-10)19-14(20)9-22-16(19)12-3-1-2-4-13(12)18-15(16)21/h1-8H,9H2,(H,18,21)/t16-/m0/s1 |
| InChIKey | MRQQVEMEOZBBNT-INIZCTEOSA-N |
| XLogP | 3.18 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.25 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|