C27H34N6O5 — CID 10973372
N-[(2R,3R,4S,5R)-2-[6-[2-(cyclohexen-1-yl)ethylamino]purin-9-yl]-4-hydroxy-5-(hydroxymethyl)oxolan-3-yl]-3-ethoxybenzamide (PubChem CID 10973372) has the molecular formula C27H34N6O5 and a molecular weight of 522.61 g/mol. Its IUPAC name is N-[(2R,3R,4S,5R)-2-[6-[2-(cyclohexen-1-yl)ethylamino]purin-9-yl]-4-hydroxy-5-(hydroxymethyl)oxolan-3-yl]-3-ethoxybenzamide.
| Compound Name | N-[(2R,3R,4S,5R)-2-[6-[2-(cyclohexen-1-yl)ethylamino]purin-9-yl]-4-hydroxy-5-(hydroxymethyl)oxolan-3-yl]-3-ethoxybenzamide |
|---|---|
| PubChem CID | 10973372 |
| Molecular Formula | C27H34N6O5 |
| Molecular Weight | 522.61 g/mol |
| Exact Mass | 522.26 |
| IUPAC Name | N-[(2R,3R,4S,5R)-2-[6-[2-(cyclohexen-1-yl)ethylamino]purin-9-yl]-4-hydroxy-5-(hydroxymethyl)oxolan-3-yl]-3-ethoxybenzamide |
| SMILES | CCOc1cccc(C(=O)N[C@@H]2[C@H](O)[C@@H](CO)O[C@H]2n2cnc3c(NCCC4=CCCCC4)ncnc32)c1 |
| InChI | InChI=1S/C27H34N6O5/c1-2-37-19-10-6-9-18(13-19)26(36)32-21-23(35)20(14-34)38-27(21)33-16-31-22-24(29-15-30-25(22)33)28-12-11-17-7-4-3-5-8-17/h6-7,9-10,13,15-16,20-21,23,27,34-35H,2-5,8,11-12,14H2,1H3,(H,32,36)(H,28,29,30)/t20-,21-,23-,27-/m1/s1 |
| InChIKey | QFXOMBAHXCSJKM-AERZDHHNSA-N |
| XLogP | 2.58 |
| TPSA | 143.65 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.61 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|