C24H33N7O8 — CID 10973629
3,4,5-trihydroxy-N-[(2R,3R,4S,5R)-4-hydroxy-5-(hydroxymethyl)-2-[6-[3-(2-oxopyrrolidin-1-yl)propylamino]purin-9-yl]oxolan-3-yl]cyclohexene-1-carboxamide (PubChem CID 10973629) has the molecular formula C24H33N7O8 and a molecular weight of 547.57 g/mol. Its IUPAC name is 3,4,5-trihydroxy-N-[(2R,3R,4S,5R)-4-hydroxy-5-(hydroxymethyl)-2-[6-[3-(2-oxopyrrolidin-1-yl)propylamino]purin-9-yl]oxolan-3-yl]cyclohexene-1-carboxamide.
| Compound Name | 3,4,5-trihydroxy-N-[(2R,3R,4S,5R)-4-hydroxy-5-(hydroxymethyl)-2-[6-[3-(2-oxopyrrolidin-1-yl)propylamino]purin-9-yl]oxolan-3-yl]cyclohexene-1-carboxamide |
|---|---|
| PubChem CID | 10973629 |
| Molecular Formula | C24H33N7O8 |
| Molecular Weight | 547.57 g/mol |
| Exact Mass | 547.24 |
| IUPAC Name | 3,4,5-trihydroxy-N-[(2R,3R,4S,5R)-4-hydroxy-5-(hydroxymethyl)-2-[6-[3-(2-oxopyrrolidin-1-yl)propylamino]purin-9-yl]oxolan-3-yl]cyclohexene-1-carboxamide |
| SMILES | O=C(N[C@@H]1[C@H](O)[C@@H](CO)O[C@H]1n1cnc2c(NCCCN3CCCC3=O)ncnc21)C1=CC(O)C(O)C(O)C1 |
| InChI | InChI=1S/C24H33N7O8/c32-9-15-20(37)17(29-23(38)12-7-13(33)19(36)14(34)8-12)24(39-15)31-11-28-18-21(26-10-27-22(18)31)25-4-2-6-30-5-1-3-16(30)35/h7,10-11,13-15,17,19-20,24,32-34,36-37H,1-6,8-9H2,(H,29,38)(H,25,26,27)/t13?,14?,15-,17-,19?,20-,24-/m1/s1 |
| InChIKey | YTMZWELGKFKUBN-NSSSYMORSA-N |
| XLogP | -2.60 |
| TPSA | 215.42 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.57 |
| LogP ≤ 5 | -2.60 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|