C26H49NO3Sn — CID 10973571
tert-butyl N-prop-2-enyl-N-[(1R,4R)-4-(tributylstannylmethoxy)cyclopent-2-en-1-yl]carbamate (PubChem CID 10973571) has the molecular formula C26H49NO3Sn and a molecular weight of 542.39 g/mol. Its IUPAC name is tert-butyl N-prop-2-enyl-N-[(1R,4R)-4-(tributylstannylmethoxy)cyclopent-2-en-1-yl]carbamate.
| Compound Name | tert-butyl N-prop-2-enyl-N-[(1R,4R)-4-(tributylstannylmethoxy)cyclopent-2-en-1-yl]carbamate |
|---|---|
| PubChem CID | 10973571 |
| Molecular Formula | C26H49NO3Sn |
| Molecular Weight | 542.39 g/mol |
| Exact Mass | 543.27 |
| IUPAC Name | tert-butyl N-prop-2-enyl-N-[(1R,4R)-4-(tributylstannylmethoxy)cyclopent-2-en-1-yl]carbamate |
| SMILES | C=CCN(C(=O)OC(C)(C)C)[C@H]1C=C[C@H](OC[Sn](CCCC)(CCCC)CCCC)C1 |
| InChI | InChI=1S/C14H22NO3.3C4H9.Sn/c1-6-9-15(13(16)18-14(2,3)4)11-7-8-12(10-11)17-5;3*1-3-4-2;/h6-8,11-12H,1,5,9-10H2,2-4H3;3*1,3-4H2,2H3;/t11-,12-;;;;/m0..../s1 |
| InChIKey | DLGZXQWWCDCMDC-RDKDOERDSA-N |
| XLogP | 7.51 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.39 |
| LogP ≤ 5 | 7.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|