C23H43NO4 — CID 144515505
tert-butyl N-[3-[(2Z)-6-methoxy-2-methylocta-2,7-dienoxy]propyl]-N-prop-2-enylcarbamate;ethane (PubChem CID 144515505) has the molecular formula C23H43NO4 and a molecular weight of 397.60 g/mol. Its IUPAC name is tert-butyl N-[3-[(2Z)-6-methoxy-2-methylocta-2,7-dienoxy]propyl]-N-prop-2-enylcarbamate;ethane.
| Compound Name | tert-butyl N-[3-[(2Z)-6-methoxy-2-methylocta-2,7-dienoxy]propyl]-N-prop-2-enylcarbamate;ethane |
|---|---|
| PubChem CID | 144515505 |
| Molecular Formula | C23H43NO4 |
| Molecular Weight | 397.60 g/mol |
| Exact Mass | 397.32 |
| IUPAC Name | tert-butyl N-[3-[(2Z)-6-methoxy-2-methylocta-2,7-dienoxy]propyl]-N-prop-2-enylcarbamate;ethane |
| SMILES | C=CCN(CCCOC/C(C)=C\CCC(C=C)OC)C(=O)OC(C)(C)C.CC |
| InChI | InChI=1S/C21H37NO4.C2H6/c1-8-14-22(20(23)26-21(4,5)6)15-11-16-25-17-18(3)12-10-13-19(9-2)24-7;1-2/h8-9,12,19H,1-2,10-11,13-17H2,3-7H3;1-2H3/b18-12-; |
| InChIKey | BDNLCIMYDHTIPD-UWRQUICRSA-N |
| XLogP | 5.77 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.60 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|