C32H38O6S — CID 10973652
(2S,3R,4S,6S)-2-methyl-6-[(2S,3R,4S,6S)-2-methyl-4-phenylmethoxy-6-phenylsulfanyloxan-3-yl]oxy-4-phenylmethoxyoxan-3-ol (PubChem CID 10973652) has the molecular formula C32H38O6S and a molecular weight of 550.72 g/mol. Its IUPAC name is (2S,3R,4S,6S)-2-methyl-6-[(2S,3R,4S,6S)-2-methyl-4-phenylmethoxy-6-phenylsulfanyloxan-3-yl]oxy-4-phenylmethoxyoxan-3-ol.
| Compound Name | (2S,3R,4S,6S)-2-methyl-6-[(2S,3R,4S,6S)-2-methyl-4-phenylmethoxy-6-phenylsulfanyloxan-3-yl]oxy-4-phenylmethoxyoxan-3-ol |
|---|---|
| PubChem CID | 10973652 |
| Molecular Formula | C32H38O6S |
| Molecular Weight | 550.72 g/mol |
| Exact Mass | 550.24 |
| IUPAC Name | (2S,3R,4S,6S)-2-methyl-6-[(2S,3R,4S,6S)-2-methyl-4-phenylmethoxy-6-phenylsulfanyloxan-3-yl]oxy-4-phenylmethoxyoxan-3-ol |
| SMILES | C[C@@H]1O[C@@H](O[C@@H]2[C@H](C)O[C@@H](Sc3ccccc3)C[C@@H]2OCc2ccccc2)C[C@H](OCc2ccccc2)[C@@H]1O |
| InChI | InChI=1S/C32H38O6S/c1-22-31(33)27(34-20-24-12-6-3-7-13-24)18-29(36-22)38-32-23(2)37-30(39-26-16-10-5-11-17-26)19-28(32)35-21-25-14-8-4-9-15-25/h3-17,22-23,27-33H,18-21H2,1-2H3/t22-,23-,27-,28-,29-,30-,31+,32+/m0/s1 |
| InChIKey | FOXAFZPYPLIXPO-VXCUGVSMSA-N |
| XLogP | 5.97 |
| TPSA | 66.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.72 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |