C5H9NO — CID 10975416
5,5-dimethyl-4H-1,3-oxazole (PubChem CID 10975416) has the molecular formula C5H9NO and a molecular weight of 99.13 g/mol. Its IUPAC name is 5,5-dimethyl-4H-1,3-oxazole.
| Compound Name | 5,5-dimethyl-4H-1,3-oxazole |
|---|---|
| PubChem CID | 10975416 |
| Molecular Formula | C5H9NO |
| Molecular Weight | 99.13 g/mol |
| Exact Mass | 99.07 |
| IUPAC Name | 5,5-dimethyl-4H-1,3-oxazole |
| SMILES | CC1(C)CN=CO1 |
| InChI | InChI=1S/C5H9NO/c1-5(2)3-6-4-7-5/h4H,3H2,1-2H3 |
| InChIKey | FYYZRSPQUGJFBF-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 7 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 99.13 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |