About 5,5-dimethyl-4H-1,3-oxazole
5,5-dimethyl-4H-1,3-oxazole (PubChem CID 10975416) has the molecular formula C5H9NO
and a molecular weight of 99.13 g/mol. Its IUPAC name is 5,5-dimethyl-4H-1,3-oxazole.
Molecular Properties
| Compound Name | 5,5-dimethyl-4H-1,3-oxazole |
| PubChem CID | 10975416 |
| Molecular Formula | C5H9NO |
| Molecular Weight | 99.13 g/mol |
| Exact Mass | 99.07 |
| IUPAC Name | 5,5-dimethyl-4H-1,3-oxazole |
| SMILES | CC1(C)CN=CO1 |
| InChI | InChI=1S/C5H9NO/c1-5(2)3-6-4-7-5/h4H,3H2,1-2H3 |
| InChIKey | FYYZRSPQUGJFBF-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 99.13 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5,5-dimethyl-4H-1,3-oxazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5,5-dimethyl-4H-1,3-oxazole?
The IUPAC name of 5,5-dimethyl-4H-1,3-oxazole (CID 10975416) is 5,5-dimethyl-4H-1,3-oxazole.
What is the SMILES notation for 5,5-dimethyl-4H-1,3-oxazole?
The canonical SMILES for 5,5-dimethyl-4H-1,3-oxazole is CC1(C)CN=CO1.
What is the InChIKey of 5,5-dimethyl-4H-1,3-oxazole?
The InChIKey is FYYZRSPQUGJFBF-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H9NO/c1-5(2)3-6-4-7-5/h4H,3H2,1-2H3.
What are the key properties of 5,5-dimethyl-4H-1,3-oxazole?
5,5-dimethyl-4H-1,3-oxazole has a molecular weight of 99.13 g/mol, XLogP of 0.82, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5,5-dimethyl-4H-1,3-oxazole is sourced from PubChem (CID 10975416), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).