C6H11NO — CID 126686768
5-ethyl-5-methyl-4H-1,3-oxazole (PubChem CID 126686768) has the molecular formula C6H11NO and a molecular weight of 113.16 g/mol. Its IUPAC name is 5-ethyl-5-methyl-4H-1,3-oxazole.
| Compound Name | 5-ethyl-5-methyl-4H-1,3-oxazole |
|---|---|
| PubChem CID | 126686768 |
| Molecular Formula | C6H11NO |
| Molecular Weight | 113.16 g/mol |
| Exact Mass | 113.08 |
| IUPAC Name | 5-ethyl-5-methyl-4H-1,3-oxazole |
| SMILES | CCC1(C)CN=CO1 |
| InChI | InChI=1S/C6H11NO/c1-3-6(2)4-7-5-8-6/h5H,3-4H2,1-2H3 |
| InChIKey | WIODMFVZVYOETR-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 113.16 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |