About 5-methyl-5-propan-2-yl-4H-1,3-oxazole;molecular fluorine;hydrofluoride
5-methyl-5-propan-2-yl-4H-1,3-oxazole;molecular fluorine;hydrofluoride (PubChem CID 161434592) has the molecular formula C7H14F7NO
and a molecular weight of 261.18 g/mol. Its IUPAC name is 5-methyl-5-propan-2-yl-4H-1,3-oxazole;molecular fluorine;hydrofluoride.
Molecular Properties
| Compound Name | 5-methyl-5-propan-2-yl-4H-1,3-oxazole;molecular fluorine;hydrofluoride |
| PubChem CID | 161434592 |
| Molecular Formula | C7H14F7NO |
| Molecular Weight | 261.18 g/mol |
| Exact Mass | 261.10 |
| IUPAC Name | 5-methyl-5-propan-2-yl-4H-1,3-oxazole;molecular fluorine;hydrofluoride |
| SMILES | CC(C)C1(C)CN=CO1.F.FF.FF.FF |
| InChI | InChI=1S/C7H13NO.3F2.FH/c1-6(2)7(3)4-8-5-9-7;3*1-2;/h5-6H,4H2,1-3H3;;;;1H |
| InChIKey | VYLZTPXGYNAYKR-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 261.18 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5-methyl-5-propan-2-yl-4H-1,3-oxazole;molecular fluorine;hydrofluoride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-methyl-5-propan-2-yl-4H-1,3-oxazole;molecular fluorine;hydrofluoride?
The IUPAC name of 5-methyl-5-propan-2-yl-4H-1,3-oxazole;molecular fluorine;hydrofluoride (CID 161434592) is 5-methyl-5-propan-2-yl-4H-1,3-oxazole;molecular fluorine;hydrofluoride.
What is the SMILES notation for 5-methyl-5-propan-2-yl-4H-1,3-oxazole;molecular fluorine;hydrofluoride?
The canonical SMILES for 5-methyl-5-propan-2-yl-4H-1,3-oxazole;molecular fluorine;hydrofluoride is CC(C)C1(C)CN=CO1.F.FF.FF.FF.
What is the InChIKey of 5-methyl-5-propan-2-yl-4H-1,3-oxazole;molecular fluorine;hydrofluoride?
The InChIKey is VYLZTPXGYNAYKR-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H13NO.3F2.FH/c1-6(2)7(3)4-8-5-9-7;3*1-2;/h5-6H,4H2,1-3H3;;;;1H.
What are the key properties of 5-methyl-5-propan-2-yl-4H-1,3-oxazole;molecular fluorine;hydrofluoride?
5-methyl-5-propan-2-yl-4H-1,3-oxazole;molecular fluorine;hydrofluoride has a molecular weight of 261.18 g/mol, XLogP of 4.13, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methyl-5-propan-2-yl-4H-1,3-oxazole;molecular fluorine;hydrofluoride is sourced from PubChem (CID 161434592), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).