About 9-hydroxydeca-2,7-diynal
9-hydroxydeca-2,7-diynal (PubChem CID 10975820) has the molecular formula C10H12O2
and a molecular weight of 164.20 g/mol. Its IUPAC name is 9-hydroxydeca-2,7-diynal.
Molecular Properties
| Compound Name | 9-hydroxydeca-2,7-diynal |
| PubChem CID | 10975820 |
| Molecular Formula | C10H12O2 |
| Molecular Weight | 164.20 g/mol |
| Exact Mass | 164.08 |
| IUPAC Name | 9-hydroxydeca-2,7-diynal |
| SMILES | CC(O)C#CCCCC#CC=O |
| InChI | InChI=1S/C10H12O2/c1-10(12)8-6-4-2-3-5-7-9-11/h9-10,12H,2-4H2,1H3 |
| InChIKey | BFFPHAQPQYBRDJ-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 164.20 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 9-hydroxydeca-2,7-diynal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9-hydroxydeca-2,7-diynal?
The IUPAC name of 9-hydroxydeca-2,7-diynal (CID 10975820) is 9-hydroxydeca-2,7-diynal.
What is the SMILES notation for 9-hydroxydeca-2,7-diynal?
The canonical SMILES for 9-hydroxydeca-2,7-diynal is CC(O)C#CCCCC#CC=O.
What is the InChIKey of 9-hydroxydeca-2,7-diynal?
The InChIKey is BFFPHAQPQYBRDJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12O2/c1-10(12)8-6-4-2-3-5-7-9-11/h9-10,12H,2-4H2,1H3.
What are the key properties of 9-hydroxydeca-2,7-diynal?
9-hydroxydeca-2,7-diynal has a molecular weight of 164.20 g/mol, XLogP of 0.74, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 9-hydroxydeca-2,7-diynal is sourced from PubChem (CID 10975820), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).