C20H24O4 — CID 171369123
(Z,9R)-dec-5-en-3,7-diyne-1,9-diol;(Z,9S)-dec-5-en-3,7-diyne-1,9-diol (PubChem CID 171369123) has the molecular formula C20H24O4 and a molecular weight of 328.41 g/mol. Its IUPAC name is (Z,9R)-dec-5-en-3,7-diyne-1,9-diol;(Z,9S)-dec-5-en-3,7-diyne-1,9-diol.
| Compound Name | (Z,9R)-dec-5-en-3,7-diyne-1,9-diol;(Z,9S)-dec-5-en-3,7-diyne-1,9-diol |
|---|---|
| PubChem CID | 171369123 |
| Molecular Formula | C20H24O4 |
| Molecular Weight | 328.41 g/mol |
| Exact Mass | 328.17 |
| IUPAC Name | (Z,9R)-dec-5-en-3,7-diyne-1,9-diol;(Z,9S)-dec-5-en-3,7-diyne-1,9-diol |
| SMILES | C[C@@H](O)C#C/C=C\C#CCCO.C[C@H](O)C#C/C=C\C#CCCO |
| InChI | InChI=1S/2C10H12O2/c2*1-10(12)8-6-4-2-3-5-7-9-11/h2*2,4,10-12H,7,9H2,1H3/b2*4-2-/t2*10-/m10/s1 |
| InChIKey | BWELOHWMLNYHGW-IEOZHJKESA-N |
| XLogP | 0.63 |
| TPSA | 80.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.41 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|