C11H16O2 — CID 10976087
(1R,3E,4R,6S)-3-(hydroxymethylidene)-4,7,7-trimethylbicyclo[4.1.0]heptan-2-one (PubChem CID 10976087) has the molecular formula C11H16O2 and a molecular weight of 180.25 g/mol. Its IUPAC name is (1R,3E,4R,6S)-3-(hydroxymethylidene)-4,7,7-trimethylbicyclo[4.1.0]heptan-2-one.
| Compound Name | (1R,3E,4R,6S)-3-(hydroxymethylidene)-4,7,7-trimethylbicyclo[4.1.0]heptan-2-one |
|---|---|
| PubChem CID | 10976087 |
| Molecular Formula | C11H16O2 |
| Molecular Weight | 180.25 g/mol |
| Exact Mass | 180.12 |
| IUPAC Name | (1R,3E,4R,6S)-3-(hydroxymethylidene)-4,7,7-trimethylbicyclo[4.1.0]heptan-2-one |
| SMILES | C[C@@H]1C[C@H]2[C@@H](C(=O)/C1=C/O)C2(C)C |
| InChI | InChI=1S/C11H16O2/c1-6-4-8-9(11(8,2)3)10(13)7(6)5-12/h5-6,8-9,12H,4H2,1-3H3/b7-5+/t6-,8+,9+/m1/s1 |
| InChIKey | OUZGCVWZIZXPES-PLUJABCSSA-N |
| XLogP | 2.31 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.25 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'keto_keto_beta_D(5)', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|