C16H24O2 — CID 86344242
(2R,4R)-2-[(1R,2R)-1-hydroxy-2-methylpenta-3,4-dienyl]-4,7,7-trimethylbicyclo[4.1.0]heptan-3-one (PubChem CID 86344242) has the molecular formula C16H24O2 and a molecular weight of 248.37 g/mol. Its IUPAC name is (2R,4R)-2-[(1R,2R)-1-hydroxy-2-methylpenta-3,4-dienyl]-4,7,7-trimethylbicyclo[4.1.0]heptan-3-one.
| Compound Name | (2R,4R)-2-[(1R,2R)-1-hydroxy-2-methylpenta-3,4-dienyl]-4,7,7-trimethylbicyclo[4.1.0]heptan-3-one |
|---|---|
| PubChem CID | 86344242 |
| Molecular Formula | C16H24O2 |
| Molecular Weight | 248.37 g/mol |
| Exact Mass | 248.18 |
| IUPAC Name | (2R,4R)-2-[(1R,2R)-1-hydroxy-2-methylpenta-3,4-dienyl]-4,7,7-trimethylbicyclo[4.1.0]heptan-3-one |
| SMILES | C=C=C[C@@H](C)[C@@H](O)[C@@H]1C(=O)[C@H](C)CC2C1C2(C)C |
| InChI | InChI=1S/C16H24O2/c1-6-7-9(2)14(17)12-13-11(16(13,4)5)8-10(3)15(12)18/h7,9-14,17H,1,8H2,2-5H3/t9-,10-,11?,12-,13?,14-/m1/s1 |
| InChIKey | XTRWAFHCGAFSJP-KPXABLDESA-N |
| XLogP | 2.82 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.37 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |