C16H26O — CID 98134213
(1S,2S,4R,6S,9S)-3,3-dimethyl-10-methylidene-9-(2-methylpropyl)-8-oxatricyclo[4.3.1.02,4]decane (PubChem CID 98134213) has the molecular formula C16H26O and a molecular weight of 234.38 g/mol. Its IUPAC name is (1S,2S,4R,6S,9S)-3,3-dimethyl-10-methylidene-9-(2-methylpropyl)-8-oxatricyclo[4.3.1.02,4]decane.
| Compound Name | (1S,2S,4R,6S,9S)-3,3-dimethyl-10-methylidene-9-(2-methylpropyl)-8-oxatricyclo[4.3.1.02,4]decane |
|---|---|
| PubChem CID | 98134213 |
| Molecular Formula | C16H26O |
| Molecular Weight | 234.38 g/mol |
| Exact Mass | 234.20 |
| IUPAC Name | (1S,2S,4R,6S,9S)-3,3-dimethyl-10-methylidene-9-(2-methylpropyl)-8-oxatricyclo[4.3.1.02,4]decane |
| SMILES | C=C1[C@H]2CO[C@@H](CC(C)C)[C@H]1[C@@H]1[C@@H](C2)C1(C)C |
| InChI | InChI=1S/C16H26O/c1-9(2)6-13-14-10(3)11(8-17-13)7-12-15(14)16(12,4)5/h9,11-15H,3,6-8H2,1-2,4-5H3/t11-,12-,13+,14+,15+/m1/s1 |
| InChIKey | RDIORAKXEXLFKD-MRLBHPIUSA-N |
| XLogP | 3.90 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.38 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|