C13H24O — CID 25421543
(2R,3R,6S)-6-methyl-2-(2-methylpropyl)-3-prop-1-en-2-yloxane (PubChem CID 25421543) has the molecular formula C13H24O and a molecular weight of 196.33 g/mol. Its IUPAC name is (2R,3R,6S)-6-methyl-2-(2-methylpropyl)-3-prop-1-en-2-yloxane.
| Compound Name | (2R,3R,6S)-6-methyl-2-(2-methylpropyl)-3-prop-1-en-2-yloxane |
|---|---|
| PubChem CID | 25421543 |
| Molecular Formula | C13H24O |
| Molecular Weight | 196.33 g/mol |
| Exact Mass | 196.18 |
| IUPAC Name | (2R,3R,6S)-6-methyl-2-(2-methylpropyl)-3-prop-1-en-2-yloxane |
| SMILES | C=C(C)[C@H]1CC[C@H](C)O[C@@H]1CC(C)C |
| InChI | InChI=1S/C13H24O/c1-9(2)8-13-12(10(3)4)7-6-11(5)14-13/h9,11-13H,3,6-8H2,1-2,4-5H3/t11-,12+,13+/m0/s1 |
| InChIKey | REJQPVBZMKPAAI-YNEHKIRRSA-N |
| XLogP | 3.79 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.33 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|