C15H24NO2+ — CID 6955169
furan-2-ylmethyl-[[(2R,3S,6R)-6-methyl-3-prop-1-en-2-yloxan-2-yl]methyl]azanium (PubChem CID 6955169) has the molecular formula C15H24NO2+ and a molecular weight of 250.36 g/mol. Its IUPAC name is furan-2-ylmethyl-[[(2R,3S,6R)-6-methyl-3-prop-1-en-2-yloxan-2-yl]methyl]azanium.
| Compound Name | furan-2-ylmethyl-[[(2R,3S,6R)-6-methyl-3-prop-1-en-2-yloxan-2-yl]methyl]azanium |
|---|---|
| PubChem CID | 6955169 |
| Molecular Formula | C15H24NO2+ |
| Molecular Weight | 250.36 g/mol |
| Exact Mass | 250.18 |
| IUPAC Name | furan-2-ylmethyl-[[(2R,3S,6R)-6-methyl-3-prop-1-en-2-yloxan-2-yl]methyl]azanium |
| SMILES | C=C(C)[C@@H]1CC[C@@H](C)O[C@H]1C[NH2+]Cc1ccco1 |
| InChI | InChI=1S/C15H23NO2/c1-11(2)14-7-6-12(3)18-15(14)10-16-9-13-5-4-8-17-13/h4-5,8,12,14-16H,1,6-7,9-10H2,2-3H3/p+1/t12-,14+,15+/m1/s1 |
| InChIKey | QFRCDAQAQCMDPU-SNPRPXQTSA-O |
| XLogP | 2.10 |
| TPSA | 38.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.36 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|