C18H31NO2 — CID 125004231
N-[(1S,5R,6S,8R,10R)-9,9-dimethyl-5-(2-methylpropyl)-4-oxatricyclo[6.2.1.01,6]undecan-10-yl]acetamide (PubChem CID 125004231) has the molecular formula C18H31NO2 and a molecular weight of 293.45 g/mol. Its IUPAC name is N-[(1S,5R,6S,8R,10R)-9,9-dimethyl-5-(2-methylpropyl)-4-oxatricyclo[6.2.1.01,6]undecan-10-yl]acetamide.
| Compound Name | N-[(1S,5R,6S,8R,10R)-9,9-dimethyl-5-(2-methylpropyl)-4-oxatricyclo[6.2.1.01,6]undecan-10-yl]acetamide |
|---|---|
| PubChem CID | 125004231 |
| Molecular Formula | C18H31NO2 |
| Molecular Weight | 293.45 g/mol |
| Exact Mass | 293.24 |
| IUPAC Name | N-[(1S,5R,6S,8R,10R)-9,9-dimethyl-5-(2-methylpropyl)-4-oxatricyclo[6.2.1.01,6]undecan-10-yl]acetamide |
| SMILES | CC(=O)N[C@@H]1C(C)(C)[C@@H]2C[C@@H]3[C@@H](CC(C)C)OCC[C@@]31C2 |
| InChI | InChI=1S/C18H31NO2/c1-11(2)8-15-14-9-13-10-18(14,6-7-21-15)16(17(13,4)5)19-12(3)20/h11,13-16H,6-10H2,1-5H3,(H,19,20)/t13-,14-,15-,16-,18-/m1/s1 |
| InChIKey | SXCIBDHUIVQNJR-XSDHEKCYSA-N |
| XLogP | 3.38 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.45 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |