About (2Z)-2-(ethoxymethylidene)-3-hydroxy-4,4-dimethylpentanenitrile
(2Z)-2-(ethoxymethylidene)-3-hydroxy-4,4-dimethylpentanenitrile (PubChem CID 10976140) has the molecular formula C10H17NO2
and a molecular weight of 183.25 g/mol. Its IUPAC name is (2Z)-2-(ethoxymethylidene)-3-hydroxy-4,4-dimethylpentanenitrile.
Molecular Properties
| Compound Name | (2Z)-2-(ethoxymethylidene)-3-hydroxy-4,4-dimethylpentanenitrile |
| PubChem CID | 10976140 |
| Molecular Formula | C10H17NO2 |
| Molecular Weight | 183.25 g/mol |
| Exact Mass | 183.13 |
| IUPAC Name | (2Z)-2-(ethoxymethylidene)-3-hydroxy-4,4-dimethylpentanenitrile |
| SMILES | CCO/C=C(/C#N)C(O)C(C)(C)C |
| InChI | InChI=1S/C10H17NO2/c1-5-13-7-8(6-11)9(12)10(2,3)4/h7,9,12H,5H2,1-4H3/b8-7- |
| InChIKey | WYSIOTAVHNHTDR-FPLPWBNLSA-N |
| XLogP | 1.84 |
| TPSA | 53.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 183.25 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|
Analyze (2Z)-2-(ethoxymethylidene)-3-hydroxy-4,4-dimethylpentanenitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2Z)-2-(ethoxymethylidene)-3-hydroxy-4,4-dimethylpentanenitrile?
The IUPAC name of (2Z)-2-(ethoxymethylidene)-3-hydroxy-4,4-dimethylpentanenitrile (CID 10976140) is (2Z)-2-(ethoxymethylidene)-3-hydroxy-4,4-dimethylpentanenitrile.
What is the SMILES notation for (2Z)-2-(ethoxymethylidene)-3-hydroxy-4,4-dimethylpentanenitrile?
The canonical SMILES for (2Z)-2-(ethoxymethylidene)-3-hydroxy-4,4-dimethylpentanenitrile is CCO/C=C(/C#N)C(O)C(C)(C)C.
What is the InChIKey of (2Z)-2-(ethoxymethylidene)-3-hydroxy-4,4-dimethylpentanenitrile?
The InChIKey is WYSIOTAVHNHTDR-FPLPWBNLSA-N. The full InChI is InChI=1S/C10H17NO2/c1-5-13-7-8(6-11)9(12)10(2,3)4/h7,9,12H,5H2,1-4H3/b8-7-.
What are the key properties of (2Z)-2-(ethoxymethylidene)-3-hydroxy-4,4-dimethylpentanenitrile?
(2Z)-2-(ethoxymethylidene)-3-hydroxy-4,4-dimethylpentanenitrile has a molecular weight of 183.25 g/mol, XLogP of 1.84, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2Z)-2-(ethoxymethylidene)-3-hydroxy-4,4-dimethylpentanenitrile is sourced from PubChem (CID 10976140), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).