C9H21NOS — CID 10976321
(R)-2-methyl-N-[(2S)-3-methylbutan-2-yl]propane-2-sulfinamide (PubChem CID 10976321) has the molecular formula C9H21NOS and a molecular weight of 191.34 g/mol. Its IUPAC name is (R)-2-methyl-N-[(2S)-3-methylbutan-2-yl]propane-2-sulfinamide.
| Compound Name | (R)-2-methyl-N-[(2S)-3-methylbutan-2-yl]propane-2-sulfinamide |
|---|---|
| PubChem CID | 10976321 |
| Molecular Formula | C9H21NOS |
| Molecular Weight | 191.34 g/mol |
| Exact Mass | 191.13 |
| IUPAC Name | (R)-2-methyl-N-[(2S)-3-methylbutan-2-yl]propane-2-sulfinamide |
| SMILES | CC(C)[C@H](C)N[S@](=O)C(C)(C)C |
| InChI | InChI=1S/C9H21NOS/c1-7(2)8(3)10-12(11)9(4,5)6/h7-8,10H,1-6H3/t8-,12+/m0/s1 |
| InChIKey | QTCVTRGYUGYRLM-QPUJVOFHSA-N |
| XLogP | 2.08 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.34 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |