C10H23NOS — CID 15416325
(R)-2-methyl-N-[(2R)-4-methylpentan-2-yl]propane-2-sulfinamide (PubChem CID 15416325) has the molecular formula C10H23NOS and a molecular weight of 205.37 g/mol. Its IUPAC name is (R)-2-methyl-N-[(2R)-4-methylpentan-2-yl]propane-2-sulfinamide.
| Compound Name | (R)-2-methyl-N-[(2R)-4-methylpentan-2-yl]propane-2-sulfinamide |
|---|---|
| PubChem CID | 15416325 |
| Molecular Formula | C10H23NOS |
| Molecular Weight | 205.37 g/mol |
| Exact Mass | 205.15 |
| IUPAC Name | (R)-2-methyl-N-[(2R)-4-methylpentan-2-yl]propane-2-sulfinamide |
| SMILES | CC(C)C[C@@H](C)N[S@](=O)C(C)(C)C |
| InChI | InChI=1S/C10H23NOS/c1-8(2)7-9(3)11-13(12)10(4,5)6/h8-9,11H,7H2,1-6H3/t9-,13-/m1/s1 |
| InChIKey | SQNVCPUAUAYWRT-NOZJJQNGSA-N |
| XLogP | 2.47 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.37 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |