About 10-thia-1,8-diazatricyclo[7.4.0.03,7]trideca-3(7),8-dien-2-one
10-thia-1,8-diazatricyclo[7.4.0.03,7]trideca-3(7),8-dien-2-one (PubChem CID 10976692) has the molecular formula C10H12N2OS
and a molecular weight of 208.29 g/mol. Its IUPAC name is 10-thia-1,8-diazatricyclo[7.4.0.03,7]trideca-3(7),8-dien-2-one.
Analyze 10-thia-1,8-diazatricyclo[7.4.0.03,7]trideca-3(7),8-dien-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 10-thia-1,8-diazatricyclo[7.4.0.03,7]trideca-3(7),8-dien-2-one?
The IUPAC name of 10-thia-1,8-diazatricyclo[7.4.0.03,7]trideca-3(7),8-dien-2-one (CID 10976692) is 10-thia-1,8-diazatricyclo[7.4.0.03,7]trideca-3(7),8-dien-2-one.
What is the SMILES notation for 10-thia-1,8-diazatricyclo[7.4.0.03,7]trideca-3(7),8-dien-2-one?
The canonical SMILES for 10-thia-1,8-diazatricyclo[7.4.0.03,7]trideca-3(7),8-dien-2-one is O=c1c2c(nc3n1CCCS3)CCC2.
What is the InChIKey of 10-thia-1,8-diazatricyclo[7.4.0.03,7]trideca-3(7),8-dien-2-one?
The InChIKey is NKMISPTYXGVZGV-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12N2OS/c13-9-7-3-1-4-8(7)11-10-12(9)5-2-6-14-10/h1-6H2.
What are the key properties of 10-thia-1,8-diazatricyclo[7.4.0.03,7]trideca-3(7),8-dien-2-one?
10-thia-1,8-diazatricyclo[7.4.0.03,7]trideca-3(7),8-dien-2-one has a molecular weight of 208.29 g/mol, XLogP of 1.23, 0 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 10-thia-1,8-diazatricyclo[7.4.0.03,7]trideca-3(7),8-dien-2-one is sourced from PubChem (CID 10976692), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).