C11H14N2OS2 — CID 10171482
2-(sulfanylmethyl)-2,3,6,7,8,9-hexahydro-[1,3]thiazolo[2,3-b]quinazolin-5-one (PubChem CID 10171482) has the molecular formula C11H14N2OS2 and a molecular weight of 254.38 g/mol. Its IUPAC name is 2-(sulfanylmethyl)-2,3,6,7,8,9-hexahydro-[1,3]thiazolo[2,3-b]quinazolin-5-one.
| Compound Name | 2-(sulfanylmethyl)-2,3,6,7,8,9-hexahydro-[1,3]thiazolo[2,3-b]quinazolin-5-one |
|---|---|
| PubChem CID | 10171482 |
| Molecular Formula | C11H14N2OS2 |
| Molecular Weight | 254.38 g/mol |
| Exact Mass | 254.05 |
| IUPAC Name | 2-(sulfanylmethyl)-2,3,6,7,8,9-hexahydro-[1,3]thiazolo[2,3-b]quinazolin-5-one |
| SMILES | O=c1c2c(nc3n1CC(CS)S3)CCCC2 |
| InChI | InChI=1S/C11H14N2OS2/c14-10-8-3-1-2-4-9(8)12-11-13(10)5-7(6-15)16-11/h7,15H,1-6H2 |
| InChIKey | PWFNAWNZMYEWEL-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 34.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.38 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|