C12H16N2OS — CID 11806641
4-methyl-3,4,7,8,9,10-hexahydro-2H-[1,3]thiazino[2,3-b]quinazolin-6-one (PubChem CID 11806641) has the molecular formula C12H16N2OS and a molecular weight of 236.34 g/mol. Its IUPAC name is 4-methyl-3,4,7,8,9,10-hexahydro-2H-[1,3]thiazino[2,3-b]quinazolin-6-one.
| Compound Name | 4-methyl-3,4,7,8,9,10-hexahydro-2H-[1,3]thiazino[2,3-b]quinazolin-6-one |
|---|---|
| PubChem CID | 11806641 |
| Molecular Formula | C12H16N2OS |
| Molecular Weight | 236.34 g/mol |
| Exact Mass | 236.10 |
| IUPAC Name | 4-methyl-3,4,7,8,9,10-hexahydro-2H-[1,3]thiazino[2,3-b]quinazolin-6-one |
| SMILES | CC1CCSc2nc3c(c(=O)n21)CCCC3 |
| InChI | InChI=1S/C12H16N2OS/c1-8-6-7-16-12-13-10-5-3-2-4-9(10)11(15)14(8)12/h8H,2-7H2,1H3 |
| InChIKey | CCAICSUXUWWHAD-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.34 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |