C11H19NO3 — CID 10976800
trans-(1S,2R)-2-(1-hydroxyethyl)-1-[2-(methoxymethoxy)ethyl]cyclobutane-1-carbonitrile (PubChem CID 10976800) has the molecular formula C11H19NO3 and a molecular weight of 213.28 g/mol. Its IUPAC name is trans-(1S,2R)-2-(1-hydroxyethyl)-1-[2-(methoxymethoxy)ethyl]cyclobutane-1-carbonitrile.
| Compound Name | trans-(1S,2R)-2-(1-hydroxyethyl)-1-[2-(methoxymethoxy)ethyl]cyclobutane-1-carbonitrile |
|---|---|
| PubChem CID | 10976800 |
| Molecular Formula | C11H19NO3 |
| Molecular Weight | 213.28 g/mol |
| Exact Mass | 213.14 |
| IUPAC Name | trans-(1S,2R)-2-(1-hydroxyethyl)-1-[2-(methoxymethoxy)ethyl]cyclobutane-1-carbonitrile |
| SMILES | COCOCC[C@@]1(C#N)CC[C@H]1C(C)O |
| InChI | InChI=1S/C11H19NO3/c1-9(13)10-3-4-11(10,7-12)5-6-15-8-14-2/h9-10,13H,3-6,8H2,1-2H3/t9?,10-,11+/m0/s1 |
| InChIKey | XMBSYBZBUFSMCY-QXXIUIOUSA-N |
| XLogP | 1.30 |
| TPSA | 62.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.28 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|