C15H17NO — CID 10977211
(4S)-4-tert-butyl-2-(2-phenylethynyl)-4,5-dihydro-1,3-oxazole (PubChem CID 10977211) has the molecular formula C15H17NO and a molecular weight of 227.31 g/mol. Its IUPAC name is (4S)-4-tert-butyl-2-(2-phenylethynyl)-4,5-dihydro-1,3-oxazole.
| Compound Name | (4S)-4-tert-butyl-2-(2-phenylethynyl)-4,5-dihydro-1,3-oxazole |
|---|---|
| PubChem CID | 10977211 |
| Molecular Formula | C15H17NO |
| Molecular Weight | 227.31 g/mol |
| Exact Mass | 227.13 |
| IUPAC Name | (4S)-4-tert-butyl-2-(2-phenylethynyl)-4,5-dihydro-1,3-oxazole |
| SMILES | CC(C)(C)[C@H]1COC(C#Cc2ccccc2)=N1 |
| InChI | InChI=1S/C15H17NO/c1-15(2,3)13-11-17-14(16-13)10-9-12-7-5-4-6-8-12/h4-8,13H,11H2,1-3H3/t13-/m1/s1 |
| InChIKey | AIINUCDOCKQQHN-CYBMUJFWSA-N |
| XLogP | 2.88 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.31 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|