C13H10F3NO — CID 134966853
(4S,5R)-2-methyl-5-(2-phenylethynyl)-4-(trifluoromethyl)-4,5-dihydro-1,3-oxazole (PubChem CID 134966853) has the molecular formula C13H10F3NO and a molecular weight of 253.22 g/mol. Its IUPAC name is (4S,5R)-2-methyl-5-(2-phenylethynyl)-4-(trifluoromethyl)-4,5-dihydro-1,3-oxazole.
| Compound Name | (4S,5R)-2-methyl-5-(2-phenylethynyl)-4-(trifluoromethyl)-4,5-dihydro-1,3-oxazole |
|---|---|
| PubChem CID | 134966853 |
| Molecular Formula | C13H10F3NO |
| Molecular Weight | 253.22 g/mol |
| Exact Mass | 253.07 |
| IUPAC Name | (4S,5R)-2-methyl-5-(2-phenylethynyl)-4-(trifluoromethyl)-4,5-dihydro-1,3-oxazole |
| SMILES | CC1=N[C@H](C(F)(F)F)[C@@H](C#Cc2ccccc2)O1 |
| InChI | InChI=1S/C13H10F3NO/c1-9-17-12(13(14,15)16)11(18-9)8-7-10-5-3-2-4-6-10/h2-6,11-12H,1H3/t11-,12+/m1/s1 |
| InChIKey | NVZNDBOISYGOMJ-NEPJUHHUSA-N |
| XLogP | 2.79 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.22 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|