C12H11NO — CID 12590489
5-methyl-2-(2-phenylethynyl)-4,5-dihydro-1,3-oxazole (PubChem CID 12590489) has the molecular formula C12H11NO and a molecular weight of 185.23 g/mol. Its IUPAC name is 5-methyl-2-(2-phenylethynyl)-4,5-dihydro-1,3-oxazole.
| Compound Name | 5-methyl-2-(2-phenylethynyl)-4,5-dihydro-1,3-oxazole |
|---|---|
| PubChem CID | 12590489 |
| Molecular Formula | C12H11NO |
| Molecular Weight | 185.23 g/mol |
| Exact Mass | 185.08 |
| IUPAC Name | 5-methyl-2-(2-phenylethynyl)-4,5-dihydro-1,3-oxazole |
| SMILES | CC1CN=C(C#Cc2ccccc2)O1 |
| InChI | InChI=1S/C12H11NO/c1-10-9-13-12(14-10)8-7-11-5-3-2-4-6-11/h2-6,10H,9H2,1H3 |
| InChIKey | OZKDOFHUYKTJGT-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.23 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|