C15H19P — CID 10977286
(2-cyclopenta-2,4-dien-1-yl-2-phenylethyl)-dimethylphosphane (PubChem CID 10977286) has the molecular formula C15H19P and a molecular weight of 230.29 g/mol. Its IUPAC name is (2-cyclopenta-2,4-dien-1-yl-2-phenylethyl)-dimethylphosphane.
| Compound Name | (2-cyclopenta-2,4-dien-1-yl-2-phenylethyl)-dimethylphosphane |
|---|---|
| PubChem CID | 10977286 |
| Molecular Formula | C15H19P |
| Molecular Weight | 230.29 g/mol |
| Exact Mass | 230.12 |
| IUPAC Name | (2-cyclopenta-2,4-dien-1-yl-2-phenylethyl)-dimethylphosphane |
| SMILES | CP(C)CC(c1ccccc1)C1C=CC=C1 |
| InChI | InChI=1S/C15H19P/c1-16(2)12-15(14-10-6-7-11-14)13-8-4-3-5-9-13/h3-11,14-15H,12H2,1-2H3 |
| InChIKey | HFDBCJBRUBWKOJ-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.29 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|