C15H21Cl3HfP- — CID 173325290
(2-cyclopenta-1,4-dien-1-yl-2-phenylethyl)-dimethylphosphane;hafnium;trihydrochloride (PubChem CID 173325290) has the molecular formula C15H21Cl3HfP- and a molecular weight of 517.16 g/mol. Its IUPAC name is (2-cyclopenta-1,4-dien-1-yl-2-phenylethyl)-dimethylphosphane;hafnium;trihydrochloride.
| Compound Name | (2-cyclopenta-1,4-dien-1-yl-2-phenylethyl)-dimethylphosphane;hafnium;trihydrochloride |
|---|---|
| PubChem CID | 173325290 |
| Molecular Formula | C15H21Cl3HfP- |
| Molecular Weight | 517.16 g/mol |
| Exact Mass | 516.99 |
| IUPAC Name | (2-cyclopenta-1,4-dien-1-yl-2-phenylethyl)-dimethylphosphane;hafnium;trihydrochloride |
| SMILES | CP(C)CC(C1=[C-]CC=C1)c1ccccc1.Cl.Cl.Cl.[Hf] |
| InChI | InChI=1S/C15H18P.3ClH.Hf/c1-16(2)12-15(14-10-6-7-11-14)13-8-4-3-5-9-13;;;;/h3-6,8-10,15H,7,12H2,1-2H3;3*1H;/q-1;;;; |
| InChIKey | ZITHEAWYYKQEJG-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.16 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|