C16H19Cl2OTi — CID 87977857
(2-cyclopenta-1,4-dien-1-yl-1-propan-2-yloxyethyl)benzene;titanium(3+);dichloride (PubChem CID 87977857) has the molecular formula C16H19Cl2OTi and a molecular weight of 346.10 g/mol. Its IUPAC name is (2-cyclopenta-1,4-dien-1-yl-1-propan-2-yloxyethyl)benzene;titanium(3+);dichloride.
| Compound Name | (2-cyclopenta-1,4-dien-1-yl-1-propan-2-yloxyethyl)benzene;titanium(3+);dichloride |
|---|---|
| PubChem CID | 87977857 |
| Molecular Formula | C16H19Cl2OTi |
| Molecular Weight | 346.10 g/mol |
| Exact Mass | 345.03 |
| IUPAC Name | (2-cyclopenta-1,4-dien-1-yl-1-propan-2-yloxyethyl)benzene;titanium(3+);dichloride |
| SMILES | CC(C)OC(CC1=[C-]CC=C1)c1ccccc1.[Cl-].[Cl-].[Ti+3] |
| InChI | InChI=1S/C16H19O.2ClH.Ti/c1-13(2)17-16(12-14-8-6-7-9-14)15-10-4-3-5-11-15;;;/h3-6,8,10-11,13,16H,7,12H2,1-2H3;2*1H;/q-1;;;+3/p-2 |
| InChIKey | IGXYCGWHANCVEP-UHFFFAOYSA-L |
| XLogP | -1.76 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.10 |
| LogP ≤ 5 | -1.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|