C9H15Br2Ti- — CID 174700866
2-(2-methylpropyl)cyclopenta-1,3-diene;titanium;dihydrobromide (PubChem CID 174700866) has the molecular formula C9H15Br2Ti- and a molecular weight of 330.89 g/mol. Its IUPAC name is 2-(2-methylpropyl)cyclopenta-1,3-diene;titanium;dihydrobromide.
| Compound Name | 2-(2-methylpropyl)cyclopenta-1,3-diene;titanium;dihydrobromide |
|---|---|
| PubChem CID | 174700866 |
| Molecular Formula | C9H15Br2Ti- |
| Molecular Weight | 330.89 g/mol |
| Exact Mass | 328.90 |
| IUPAC Name | 2-(2-methylpropyl)cyclopenta-1,3-diene;titanium;dihydrobromide |
| SMILES | Br.Br.CC(C)CC1=[C-]CC=C1.[Ti] |
| InChI | InChI=1S/C9H13.2BrH.Ti/c1-8(2)7-9-5-3-4-6-9;;;/h3,5,8H,4,7H2,1-2H3;2*1H;/q-1;;; |
| InChIKey | FVFUUNUNNDTNAQ-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.89 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|