C9H13Hf- — CID 174617018
hafnium;2-(2-methylpropyl)cyclopenta-1,3-diene (PubChem CID 174617018) has the molecular formula C9H13Hf- and a molecular weight of 299.69 g/mol. Its IUPAC name is hafnium;2-(2-methylpropyl)cyclopenta-1,3-diene.
| Compound Name | hafnium;2-(2-methylpropyl)cyclopenta-1,3-diene |
|---|---|
| PubChem CID | 174617018 |
| Molecular Formula | C9H13Hf- |
| Molecular Weight | 299.69 g/mol |
| Exact Mass | 301.05 |
| IUPAC Name | hafnium;2-(2-methylpropyl)cyclopenta-1,3-diene |
| SMILES | CC(C)CC1=[C-]CC=C1.[Hf] |
| InChI | InChI=1S/C9H13.Hf/c1-8(2)7-9-5-3-4-6-9;/h3,5,8H,4,7H2,1-2H3;/q-1; |
| InChIKey | HHTCJWQWDIMVIB-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.69 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|