C9H14ClTi- — CID 174945783
2-(2-methylpropyl)cyclopenta-1,3-diene;titanium;hydrochloride (PubChem CID 174945783) has the molecular formula C9H14ClTi- and a molecular weight of 205.53 g/mol. Its IUPAC name is 2-(2-methylpropyl)cyclopenta-1,3-diene;titanium;hydrochloride.
| Compound Name | 2-(2-methylpropyl)cyclopenta-1,3-diene;titanium;hydrochloride |
|---|---|
| PubChem CID | 174945783 |
| Molecular Formula | C9H14ClTi- |
| Molecular Weight | 205.53 g/mol |
| Exact Mass | 205.03 |
| IUPAC Name | 2-(2-methylpropyl)cyclopenta-1,3-diene;titanium;hydrochloride |
| SMILES | CC(C)CC1=[C-]CC=C1.Cl.[Ti] |
| InChI | InChI=1S/C9H13.ClH.Ti/c1-8(2)7-9-5-3-4-6-9;;/h3,5,8H,4,7H2,1-2H3;1H;/q-1;; |
| InChIKey | NAVRYBNVNBKOHT-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.53 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|