C16H28O3 — CID 10978476
[(1R,2R)-1-cyclohexyl-2-methyl-4-oxobutyl] 2,2-dimethylpropanoate (PubChem CID 10978476) has the molecular formula C16H28O3 and a molecular weight of 268.40 g/mol. Its IUPAC name is [(1R,2R)-1-cyclohexyl-2-methyl-4-oxobutyl] 2,2-dimethylpropanoate.
| Compound Name | [(1R,2R)-1-cyclohexyl-2-methyl-4-oxobutyl] 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 10978476 |
| Molecular Formula | C16H28O3 |
| Molecular Weight | 268.40 g/mol |
| Exact Mass | 268.20 |
| IUPAC Name | [(1R,2R)-1-cyclohexyl-2-methyl-4-oxobutyl] 2,2-dimethylpropanoate |
| SMILES | C[C@H](CC=O)[C@@H](OC(=O)C(C)(C)C)C1CCCCC1 |
| InChI | InChI=1S/C16H28O3/c1-12(10-11-17)14(13-8-6-5-7-9-13)19-15(18)16(2,3)4/h11-14H,5-10H2,1-4H3/t12-,14-/m1/s1 |
| InChIKey | VHCPKJSBAHZKSE-TZMCWYRMSA-N |
| XLogP | 3.75 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.40 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|