C13H24O2 — CID 101013747
(1S,2R)-1-cyclohexyl-1-methoxy-2-methylpentan-3-one (PubChem CID 101013747) has the molecular formula C13H24O2 and a molecular weight of 212.33 g/mol. Its IUPAC name is (1S,2R)-1-cyclohexyl-1-methoxy-2-methylpentan-3-one.
| Compound Name | (1S,2R)-1-cyclohexyl-1-methoxy-2-methylpentan-3-one |
|---|---|
| PubChem CID | 101013747 |
| Molecular Formula | C13H24O2 |
| Molecular Weight | 212.33 g/mol |
| Exact Mass | 212.18 |
| IUPAC Name | (1S,2R)-1-cyclohexyl-1-methoxy-2-methylpentan-3-one |
| SMILES | CCC(=O)[C@H](C)[C@@H](OC)C1CCCCC1 |
| InChI | InChI=1S/C13H24O2/c1-4-12(14)10(2)13(15-3)11-8-6-5-7-9-11/h10-11,13H,4-9H2,1-3H3/t10-,13+/m0/s1 |
| InChIKey | IALVDRTZOUYZHB-GXFFZTMASA-N |
| XLogP | 3.20 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.33 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |