C13H26O3 — CID 141338727
[1,3-dimethoxy-2-(methoxymethyl)propyl]cyclohexane (PubChem CID 141338727) has the molecular formula C13H26O3 and a molecular weight of 230.35 g/mol. Its IUPAC name is [1,3-dimethoxy-2-(methoxymethyl)propyl]cyclohexane.
| Compound Name | [1,3-dimethoxy-2-(methoxymethyl)propyl]cyclohexane |
|---|---|
| PubChem CID | 141338727 |
| Molecular Formula | C13H26O3 |
| Molecular Weight | 230.35 g/mol |
| Exact Mass | 230.19 |
| IUPAC Name | [1,3-dimethoxy-2-(methoxymethyl)propyl]cyclohexane |
| SMILES | COCC(COC)C(OC)C1CCCCC1 |
| InChI | InChI=1S/C13H26O3/c1-14-9-12(10-15-2)13(16-3)11-7-5-4-6-8-11/h11-13H,4-10H2,1-3H3 |
| InChIKey | QVADKXUXMNYQMA-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.35 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |