C13H26O2 — CID 142709814
(1,4-dimethoxy-3-methylbutan-2-yl)cyclohexane (PubChem CID 142709814) has the molecular formula C13H26O2 and a molecular weight of 214.35 g/mol. Its IUPAC name is (1,4-dimethoxy-3-methylbutan-2-yl)cyclohexane.
| Compound Name | (1,4-dimethoxy-3-methylbutan-2-yl)cyclohexane |
|---|---|
| PubChem CID | 142709814 |
| Molecular Formula | C13H26O2 |
| Molecular Weight | 214.35 g/mol |
| Exact Mass | 214.19 |
| IUPAC Name | (1,4-dimethoxy-3-methylbutan-2-yl)cyclohexane |
| SMILES | COCC(C)C(COC)C1CCCCC1 |
| InChI | InChI=1S/C13H26O2/c1-11(9-14-2)13(10-15-3)12-7-5-4-6-8-12/h11-13H,4-10H2,1-3H3 |
| InChIKey | KGFARMBGAKQXMB-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.35 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |