C14H21FO2Si — CID 10978481
(2,4,6-trimethylphenyl) 2-fluoro-2-trimethylsilylacetate (PubChem CID 10978481) has the molecular formula C14H21FO2Si and a molecular weight of 268.40 g/mol. Its IUPAC name is (2,4,6-trimethylphenyl) 2-fluoro-2-trimethylsilylacetate.
| Compound Name | (2,4,6-trimethylphenyl) 2-fluoro-2-trimethylsilylacetate |
|---|---|
| PubChem CID | 10978481 |
| Molecular Formula | C14H21FO2Si |
| Molecular Weight | 268.40 g/mol |
| Exact Mass | 268.13 |
| IUPAC Name | (2,4,6-trimethylphenyl) 2-fluoro-2-trimethylsilylacetate |
| SMILES | Cc1cc(C)c(OC(=O)C(F)[Si](C)(C)C)c(C)c1 |
| InChI | InChI=1S/C14H21FO2Si/c1-9-7-10(2)12(11(3)8-9)17-14(16)13(15)18(4,5)6/h7-8,13H,1-6H3 |
| InChIKey | OFVUHULNKYJSSJ-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.40 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|