C13H12F6O2 — CID 2748449
(2,4,6-trimethylphenyl) 3,3,3-trifluoro-2-(trifluoromethyl)propanoate (PubChem CID 2748449) has the molecular formula C13H12F6O2 and a molecular weight of 314.23 g/mol. Its IUPAC name is (2,4,6-trimethylphenyl) 3,3,3-trifluoro-2-(trifluoromethyl)propanoate.
| Compound Name | (2,4,6-trimethylphenyl) 3,3,3-trifluoro-2-(trifluoromethyl)propanoate |
|---|---|
| PubChem CID | 2748449 |
| Molecular Formula | C13H12F6O2 |
| Molecular Weight | 314.23 g/mol |
| Exact Mass | 314.07 |
| IUPAC Name | (2,4,6-trimethylphenyl) 3,3,3-trifluoro-2-(trifluoromethyl)propanoate |
| SMILES | Cc1cc(C)c(OC(=O)C(C(F)(F)F)C(F)(F)F)c(C)c1 |
| InChI | InChI=1S/C13H12F6O2/c1-6-4-7(2)9(8(3)5-6)21-11(20)10(12(14,15)16)13(17,18)19/h4-5,10H,1-3H3 |
| InChIKey | PKEXTOYPMJZLOK-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.23 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|