C24H18F12O4 — CID 130209980
1-O-[2-methyl-4,6-bis(trifluoromethyl)phenyl] 3-O-[4-methyl-2,6-bis(trifluoromethyl)phenyl] 2-propylpropanedioate (PubChem CID 130209980) has the molecular formula C24H18F12O4 and a molecular weight of 598.38 g/mol. Its IUPAC name is 1-O-[2-methyl-4,6-bis(trifluoromethyl)phenyl] 3-O-[4-methyl-2,6-bis(trifluoromethyl)phenyl] 2-propylpropanedioate.
| Compound Name | 1-O-[2-methyl-4,6-bis(trifluoromethyl)phenyl] 3-O-[4-methyl-2,6-bis(trifluoromethyl)phenyl] 2-propylpropanedioate |
|---|---|
| PubChem CID | 130209980 |
| Molecular Formula | C24H18F12O4 |
| Molecular Weight | 598.38 g/mol |
| Exact Mass | 598.10 |
| IUPAC Name | 1-O-[2-methyl-4,6-bis(trifluoromethyl)phenyl] 3-O-[4-methyl-2,6-bis(trifluoromethyl)phenyl] 2-propylpropanedioate |
| SMILES | CCCC(C(=O)Oc1c(C)cc(C(F)(F)F)cc1C(F)(F)F)C(=O)Oc1c(C(F)(F)F)cc(C)cc1C(F)(F)F |
| InChI | InChI=1S/C24H18F12O4/c1-4-5-13(19(37)39-17-11(3)8-12(21(25,26)27)9-16(17)24(34,35)36)20(38)40-18-14(22(28,29)30)6-10(2)7-15(18)23(31,32)33/h6-9,13H,4-5H2,1-3H3 |
| InChIKey | RPSUSVWBKJBGGY-UHFFFAOYSA-N |
| XLogP | 8.31 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.38 |
| LogP ≤ 5 | 8.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|