About [2-methyl-4,6-bis(trifluoromethyl)phenyl] N-[4-(difluoromethoxy)phenyl]-N-methylcarbamate
[2-methyl-4,6-bis(trifluoromethyl)phenyl] N-[4-(difluoromethoxy)phenyl]-N-methylcarbamate (PubChem CID 171507243) has the molecular formula C18H13F8NO3
and a molecular weight of 443.29 g/mol. Its IUPAC name is [2-methyl-4,6-bis(trifluoromethyl)phenyl] N-[4-(difluoromethoxy)phenyl]-N-methylcarbamate.
Molecular Properties
| Compound Name | [2-methyl-4,6-bis(trifluoromethyl)phenyl] N-[4-(difluoromethoxy)phenyl]-N-methylcarbamate |
| PubChem CID | 171507243 |
| Molecular Formula | C18H13F8NO3 |
| Molecular Weight | 443.29 g/mol |
| Exact Mass | 443.08 |
| IUPAC Name | [2-methyl-4,6-bis(trifluoromethyl)phenyl] N-[4-(difluoromethoxy)phenyl]-N-methylcarbamate |
| SMILES | Cc1cc(C(F)(F)F)cc(C(F)(F)F)c1OC(=O)N(C)c1ccc(OC(F)F)cc1 |
| InChI | InChI=1S/C18H13F8NO3/c1-9-7-10(17(21,22)23)8-13(18(24,25)26)14(9)30-16(28)27(2)11-3-5-12(6-4-11)29-15(19)20/h3-8,15H,1-2H3 |
| InChIKey | WARPLFILPVOTDL-UHFFFAOYSA-N |
| XLogP | 6.27 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 443.29 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze [2-methyl-4,6-bis(trifluoromethyl)phenyl] N-[4-(difluoromethoxy)phenyl]-N-methylcarbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-methyl-4,6-bis(trifluoromethyl)phenyl] N-[4-(difluoromethoxy)phenyl]-N-methylcarbamate?
The IUPAC name of [2-methyl-4,6-bis(trifluoromethyl)phenyl] N-[4-(difluoromethoxy)phenyl]-N-methylcarbamate (CID 171507243) is [2-methyl-4,6-bis(trifluoromethyl)phenyl] N-[4-(difluoromethoxy)phenyl]-N-methylcarbamate.
What is the SMILES notation for [2-methyl-4,6-bis(trifluoromethyl)phenyl] N-[4-(difluoromethoxy)phenyl]-N-methylcarbamate?
The canonical SMILES for [2-methyl-4,6-bis(trifluoromethyl)phenyl] N-[4-(difluoromethoxy)phenyl]-N-methylcarbamate is Cc1cc(C(F)(F)F)cc(C(F)(F)F)c1OC(=O)N(C)c1ccc(OC(F)F)cc1.
What is the InChIKey of [2-methyl-4,6-bis(trifluoromethyl)phenyl] N-[4-(difluoromethoxy)phenyl]-N-methylcarbamate?
The InChIKey is WARPLFILPVOTDL-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H13F8NO3/c1-9-7-10(17(21,22)23)8-13(18(24,25)26)14(9)30-16(28)27(2)11-3-5-12(6-4-11)29-15(19)20/h3-8,15H,1-2H3.
What are the key properties of [2-methyl-4,6-bis(trifluoromethyl)phenyl] N-[4-(difluoromethoxy)phenyl]-N-methylcarbamate?
[2-methyl-4,6-bis(trifluoromethyl)phenyl] N-[4-(difluoromethoxy)phenyl]-N-methylcarbamate has a molecular weight of 443.29 g/mol, XLogP of 6.27, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [2-methyl-4,6-bis(trifluoromethyl)phenyl] N-[4-(difluoromethoxy)phenyl]-N-methylcarbamate is sourced from PubChem (CID 171507243), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).