C25H24F7N3O3 — CID 171837622
[2-[(Z)-1-amino-3-(2-cyclobutyloxyethylimino)prop-1-en-2-yl]-4,6-bis(trifluoromethyl)phenyl] N-(4-fluorophenyl)-N-methylcarbamate (PubChem CID 171837622) has the molecular formula C25H24F7N3O3 and a molecular weight of 547.47 g/mol. Its IUPAC name is [2-[(Z)-1-amino-3-(2-cyclobutyloxyethylimino)prop-1-en-2-yl]-4,6-bis(trifluoromethyl)phenyl] N-(4-fluorophenyl)-N-methylcarbamate.
| Compound Name | [2-[(Z)-1-amino-3-(2-cyclobutyloxyethylimino)prop-1-en-2-yl]-4,6-bis(trifluoromethyl)phenyl] N-(4-fluorophenyl)-N-methylcarbamate |
|---|---|
| PubChem CID | 171837622 |
| Molecular Formula | C25H24F7N3O3 |
| Molecular Weight | 547.47 g/mol |
| Exact Mass | 547.17 |
| IUPAC Name | [2-[(Z)-1-amino-3-(2-cyclobutyloxyethylimino)prop-1-en-2-yl]-4,6-bis(trifluoromethyl)phenyl] N-(4-fluorophenyl)-N-methylcarbamate |
| SMILES | CN(C(=O)Oc1c(C(=C/N)/C=N/CCOC2CCC2)cc(C(F)(F)F)cc1C(F)(F)F)c1ccc(F)cc1 |
| InChI | InChI=1S/C25H24F7N3O3/c1-35(18-7-5-17(26)6-8-18)23(36)38-22-20(11-16(24(27,28)29)12-21(22)25(30,31)32)15(13-33)14-34-9-10-37-19-3-2-4-19/h5-8,11-14,19H,2-4,9-10,33H2,1H3/b15-13+,34-14+ |
| InChIKey | KAZBPNMLTVBSCE-BHARAOOCSA-N |
| XLogP | 6.44 |
| TPSA | 77.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.47 |
| LogP ≤ 5 | 6.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|