About [2-ethynyl-4,6-bis(trifluoromethyl)phenyl] N-(4-fluorophenyl)-N-methylcarbamate
[2-ethynyl-4,6-bis(trifluoromethyl)phenyl] N-(4-fluorophenyl)-N-methylcarbamate (PubChem CID 171837134) has the molecular formula C18H10F7NO2
and a molecular weight of 405.27 g/mol. Its IUPAC name is [2-ethynyl-4,6-bis(trifluoromethyl)phenyl] N-(4-fluorophenyl)-N-methylcarbamate.
Molecular Properties
| Compound Name | [2-ethynyl-4,6-bis(trifluoromethyl)phenyl] N-(4-fluorophenyl)-N-methylcarbamate |
| PubChem CID | 171837134 |
| Molecular Formula | C18H10F7NO2 |
| Molecular Weight | 405.27 g/mol |
| Exact Mass | 405.06 |
| IUPAC Name | [2-ethynyl-4,6-bis(trifluoromethyl)phenyl] N-(4-fluorophenyl)-N-methylcarbamate |
| SMILES | C#Cc1cc(C(F)(F)F)cc(C(F)(F)F)c1OC(=O)N(C)c1ccc(F)cc1 |
| InChI | InChI=1S/C18H10F7NO2/c1-3-10-8-11(17(20,21)22)9-14(18(23,24)25)15(10)28-16(27)26(2)13-6-4-12(19)5-7-13/h1,4-9H,2H3 |
| InChIKey | XJDYSLXRAXVAMH-UHFFFAOYSA-N |
| XLogP | 5.48 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 405.27 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze [2-ethynyl-4,6-bis(trifluoromethyl)phenyl] N-(4-fluorophenyl)-N-methylcarbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-ethynyl-4,6-bis(trifluoromethyl)phenyl] N-(4-fluorophenyl)-N-methylcarbamate?
The IUPAC name of [2-ethynyl-4,6-bis(trifluoromethyl)phenyl] N-(4-fluorophenyl)-N-methylcarbamate (CID 171837134) is [2-ethynyl-4,6-bis(trifluoromethyl)phenyl] N-(4-fluorophenyl)-N-methylcarbamate.
What is the SMILES notation for [2-ethynyl-4,6-bis(trifluoromethyl)phenyl] N-(4-fluorophenyl)-N-methylcarbamate?
The canonical SMILES for [2-ethynyl-4,6-bis(trifluoromethyl)phenyl] N-(4-fluorophenyl)-N-methylcarbamate is C#Cc1cc(C(F)(F)F)cc(C(F)(F)F)c1OC(=O)N(C)c1ccc(F)cc1.
What is the InChIKey of [2-ethynyl-4,6-bis(trifluoromethyl)phenyl] N-(4-fluorophenyl)-N-methylcarbamate?
The InChIKey is XJDYSLXRAXVAMH-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H10F7NO2/c1-3-10-8-11(17(20,21)22)9-14(18(23,24)25)15(10)28-16(27)26(2)13-6-4-12(19)5-7-13/h1,4-9H,2H3.
What are the key properties of [2-ethynyl-4,6-bis(trifluoromethyl)phenyl] N-(4-fluorophenyl)-N-methylcarbamate?
[2-ethynyl-4,6-bis(trifluoromethyl)phenyl] N-(4-fluorophenyl)-N-methylcarbamate has a molecular weight of 405.27 g/mol, XLogP of 5.48, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [2-ethynyl-4,6-bis(trifluoromethyl)phenyl] N-(4-fluorophenyl)-N-methylcarbamate is sourced from PubChem (CID 171837134), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).