C18H7B2F7INO3S — CID 171837227
CID 171837227 (PubChem CID 171837227) has the molecular formula C18H7B2F7INO3S and a molecular weight of 598.84 g/mol.
| Compound Name | CID 171837227 |
|---|---|
| PubChem CID | 171837227 |
| Molecular Formula | C18H7B2F7INO3S |
| Molecular Weight | 598.84 g/mol |
| Exact Mass | 598.93 |
| IUPAC Name | — |
| SMILES | [B]C([B])(O)N(C(=O)Oc1c(C#CSI)cc(C(F)(F)F)cc1C(F)(F)F)c1ccc(F)cc1 |
| InChI | InChI=1S/C18H7B2F7INO3S/c19-18(20,31)29(12-3-1-11(21)2-4-12)15(30)32-14-9(5-6-33-28)7-10(16(22,23)24)8-13(14)17(25,26)27/h1-4,7-8,31H |
| InChIKey | ITQUCGUQLMLEMG-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.84 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|