C19H13B3ClF8NO2 — CID 171837155
CID 171837155 (PubChem CID 171837155) has the molecular formula C19H13B3ClF8NO2 and a molecular weight of 507.19 g/mol.
| Compound Name | CID 171837155 |
|---|---|
| PubChem CID | 171837155 |
| Molecular Formula | C19H13B3ClF8NO2 |
| Molecular Weight | 507.19 g/mol |
| Exact Mass | 507.08 |
| IUPAC Name | — |
| SMILES | CC.[B]C([B])([B])N(C(=O)Oc1c(C)cc(C(F)(F)F)cc1C(F)(F)F)c1ccc(F)c(Cl)c1F |
| InChI | InChI=1S/C17H7B3ClF8NO2.C2H6/c1-6-4-7(15(24,25)26)5-8(16(27,28)29)13(6)32-14(31)30(17(18,19)20)10-3-2-9(22)11(21)12(10)23;1-2/h2-5H,1H3;1-2H3 |
| InChIKey | IVYHMYUQONDWJL-UHFFFAOYSA-N |
| XLogP | 6.11 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.19 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|